4,4'-oxybis[2,6-dibromoaniline] structure
|
Common Name | 4,4'-oxybis[2,6-dibromoaniline] | ||
|---|---|---|---|---|
| CAS Number | 61381-91-7 | Molecular Weight | 515.82100 | |
| Density | 2.249g/cm3 | Boiling Point | 486ºC at 760 mmHg | |
| Molecular Formula | C12H8Br4N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
| Name | 4-(4-amino-3,5-dibromophenoxy)-2,6-dibromoaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 2.249g/cm3 |
|---|---|
| Boiling Point | 486ºC at 760 mmHg |
| Molecular Formula | C12H8Br4N2O |
| Molecular Weight | 515.82100 |
| Flash Point | 247.7ºC |
| Exact Mass | 511.73700 |
| PSA | 61.27000 |
| LogP | 6.85570 |
| Index of Refraction | 1.734 |
| InChIKey | XILHJTXOEMTUQR-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(Oc2cc(Br)c(N)c(Br)c2)cc1Br |
| HS Code | 2922199090 |
|---|
|
~90%
4,4'-oxybis[2,6... CAS#:61381-91-7 |
| Literature: Hajipour; Imanieh; Pourmousavi Synthetic Communications, 2004 , vol. 34, # 24 p. 4597 - 4604 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-diamino-3,5,3',5'-tetrabromo-diphenylether |
| 3,3',5,5'-tetrabromo-4,4'-diaminodiphenyl ether |
| EINECS 262-753-3 |