naphthalen-2-yl N-tert-butylcarbamate structure
|
Common Name | naphthalen-2-yl N-tert-butylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 61382-92-1 | Molecular Weight | 243.30100 | |
| Density | 1.108g/cm3 | Boiling Point | 358.3ºC at 760 mmHg | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | naphthalen-2-yl N-tert-butylcarbamate |
|---|
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 358.3ºC at 760 mmHg |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30100 |
| Flash Point | 170.5ºC |
| Exact Mass | 243.12600 |
| PSA | 38.33000 |
| LogP | 4.11760 |
| Index of Refraction | 1.578 |
| InChIKey | VIUHSSNMQRNVBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)Oc1ccc2ccccc2c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |