1-isopropenyl-4-methylhex-5-enyl acetate
Modify Date: 2025-08-26 19:03:59
1-isopropenyl-4-methylhex-5-enyl acetate structure
|
Common Name | 1-isopropenyl-4-methylhex-5-enyl acetate | ||
|---|---|---|---|---|
| CAS Number | 61382-99-8 | Molecular Weight | 196.28600 | |
| Density | 0.888g/cm3 | Boiling Point | 249.9ºC at 760 mmHg | |
| Molecular Formula | C12H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.3ºC | |
| Name | 2,6-dimethylocta-1,7-dien-3-yl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.888g/cm3 |
|---|---|
| Boiling Point | 249.9ºC at 760 mmHg |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.28600 |
| Flash Point | 85.3ºC |
| Exact Mass | 196.14600 |
| PSA | 26.30000 |
| LogP | 3.09650 |
| Index of Refraction | 1.443 |
| InChIKey | ATOCHKMVAHBPNF-UHFFFAOYSA-N |
| SMILES | C=CC(C)CCC(OC(C)=O)C(=C)C |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| EINECS 262-754-9 |
| 1-isopropenyl-4-methylhex-5-enyl acetate |
| 2,6-Dimethyl-1,7-octadien-3-ol,acetate |