N-(4-Bromophenyl)-4-(4-fluorophenyl)-2-thiazolamine
Modify Date: 2025-08-22 16:34:14
N-(4-Bromophenyl)-4-(4-fluorophenyl)-2-thiazolamine structure
|
Common Name | N-(4-Bromophenyl)-4-(4-fluorophenyl)-2-thiazolamine | ||
|---|---|---|---|---|
| CAS Number | 61383-57-1 | Molecular Weight | 349.22100 | |
| Density | 1.56g/cm3 | Boiling Point | 463ºC at 760 mmHg | |
| Molecular Formula | C15H10BrFN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.8ºC | |
| Name | N-(4-bromophenyl)-4-(4-fluorophenyl)-1,3-thiazol-2-amine |
|---|
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 463ºC at 760 mmHg |
| Molecular Formula | C15H10BrFN2S |
| Molecular Weight | 349.22100 |
| Flash Point | 233.8ºC |
| Exact Mass | 347.97300 |
| PSA | 53.16000 |
| LogP | 5.52830 |
| Index of Refraction | 1.677 |
| InChIKey | GJCNMVXIUMVYDI-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2csc(Nc3ccc(Br)cc3)n2)cc1 |
| HS Code | 2934100090 |
|---|
|
~95%
N-(4-Bromopheny... CAS#:61383-57-1 |
| Literature: Gupta, Ragini; Sharma, Deepti; Singh, Swaroop Phosphorus, Sulfur and Silicon and the Related Elements, 2010 , vol. 185, # 7 p. 1321 - 1331 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |