5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione
5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione structure
|
Common Name | 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 61386-99-0 | Molecular Weight | 316.53500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7BrClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H7BrClNO3 |
|---|---|
| Molecular Weight | 316.53500 |
| Exact Mass | 314.93000 |
| PSA | 52.21000 |
| LogP | 2.51500 |
| InChIKey | BBSLCQNJSDBJQA-UHFFFAOYSA-N |
| SMILES | Cc1oc(=O)n(-c2cccc(Cl)c2)c(=O)c1Br |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-bromo-3-(3-ch... CAS#:61386-99-0 |
| Literature: Jaeger,G.; Wenzelburger,J. Justus Liebigs Annalen der Chemie, 1976 , p. 1689 - 1712 |
|
~%
5-bromo-3-(3-ch... CAS#:61386-99-0 |
| Literature: Jaeger,G.; Wenzelburger,J. Justus Liebigs Annalen der Chemie, 1976 , p. 1689 - 1712 |
|
~%
5-bromo-3-(3-ch... CAS#:61386-99-0 |
| Literature: Jaeger,G.; Wenzelburger,J. Justus Liebigs Annalen der Chemie, 1976 , p. 1689 - 1712 |
![5,6-dibromo-3-(3-chloro-phenyl)-6-methyl-[1,3]oxazinane-2,4-dione structure](https://image.chemsrc.com/caspic/062/61386-90-1.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione? |
| A: SMILES notation of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione is Cc1oc(=O)n(-c2cccc(Cl)c2)c(=O)c1Br. |
| Q: What is the InChIKey of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione? |
| A: InChIKey of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione is BBSLCQNJSDBJQA-UHFFFAOYSA-N. |
| Q: What is the English name of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione? |
| A: The English name of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione is 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione. |
| Q: What is the LogP of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione? |
| A: LogP of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione is 2.51500. |
| Q: What is the polar surface area (PSA) of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione? |
| A: Polar surface area (PSA) of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione is 52.21000. |
| Q: What is the Chinese name of 61386-99-0? |
| A: Chinese name of 61386-99-0 is 61386-99-0. |
| Q: What is the molecular weight of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione? |
| A: Molecular weight of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione is 316.53500. |
| Q: What is the CAS number of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione? |
| A: CAS number of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione is 61386-99-0. |
| Q: What is the molecular formula of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione? |
| A: Molecular formula of 5-bromo-3-(3-chlorophenyl)-6-methyl-1,3-oxazine-2,4-dione is C11H7BrClNO3. |