Prehelminthosporal
Modify Date: 2025-10-02 14:28:32
Prehelminthosporal structure
|
Common Name | Prehelminthosporal | ||
|---|---|---|---|---|
| CAS Number | 61391-22-8 | Molecular Weight | 234.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Prehelminthosporal |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22O2 |
|---|---|
| Molecular Weight | 234.33 |
| InChIKey | BUZSJKZYPFIRLY-FQKPHLNHSA-N |
| SMILES | C=C1C(C=O)C2C(C(C)C)CCC1(C)C2C=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Prehelminthosporal? |
| A: Molecular weight of Prehelminthosporal is 234.33. |
| Q: What is the Chinese name of 61391-22-8? |
| A: Chinese name of 61391-22-8 is 61391-22-8. |
| Q: What is the CAS number of Prehelminthosporal? |
| A: CAS number of Prehelminthosporal is 61391-22-8. |
| Q: What is the SMILES notation of Prehelminthosporal? |
| A: SMILES notation of Prehelminthosporal is C=C1C(C=O)C2C(C(C)C)CCC1(C)C2C=O. |
| Q: What is the InChIKey of Prehelminthosporal? |
| A: InChIKey of Prehelminthosporal is BUZSJKZYPFIRLY-FQKPHLNHSA-N. |
| Q: What is the English name of Prehelminthosporal? |
| A: The English name of Prehelminthosporal is Prehelminthosporal. |
| Q: What is the molecular formula of Prehelminthosporal? |
| A: Molecular formula of Prehelminthosporal is C15H22O2. |