Glycerol, tribenzoate structure
|
Common Name | Glycerol, tribenzoate | ||
|---|---|---|---|---|
| CAS Number | 614-33-5 | Molecular Weight | 404.412 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 548.9±17.0 °C at 760 mmHg | |
| Molecular Formula | C24H20O6 | Melting Point | 68-72ºC | |
| MSDS | USA | Flash Point | 238.1±21.0 °C | |
| Name | 2,3-dibenzoyloxypropyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 548.9±17.0 °C at 760 mmHg |
| Melting Point | 68-72ºC |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.412 |
| Flash Point | 238.1±21.0 °C |
| Exact Mass | 404.125977 |
| PSA | 78.90000 |
| LogP | 7.12 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | HIZCTWCPHWUPFU-UHFFFAOYSA-N |
| SMILES | O=C(OCC(COC(=O)c1ccccc1)OC(=O)c1ccccc1)c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
|
Quantitative analysis of glycerol levels in human urine by liquid chromatography–tandem mass spectrometry
J. Chromatogr. B. Analyt. Technol. Biomed. Life Sci. 957 , 30-5, (2014) • Developed a novel LC–MS/MS method for the quantitation of glycerol in human urine. • High specificity, sensitivity, throughput and wide linearity range (1–1000μg/mL). • Modifications in sample pretr... |
| Propane-1,2,3-triyl tribenzoate |
| EINECS 210-379-6 |
| MFCD00020677 |
| FEMA No. 3398 |
| Glyceryl tribenzoate |
| 1,2,3-Tris-benzoyloxy-propan |
| Glycerol tribenzoate |
| 1,2,3-tris-benzoyloxy-propane |
| 1,2,3-tri-O-benzoylglycerol |
| Tribenzoin |
| Glycerol, tribenzoate |
| Glycerintribenzoat |
| 1,2,3-PROPANETRIOL,TRIBENZOATE |
| 1,2,3-Propanetriol, tribenzoate |
| 1,2,3-Propanetriyl tribenzoate |
| tri-O-benzoyl-glycerol |