[2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol
![[2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol Structure](https://image.chemsrc.com/caspic/270/61447-99-2.png)
[2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol structure
|
Common Name | [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 61447-99-2 | Molecular Weight | 204.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20O |
|---|---|
| Molecular Weight | 204.30800 |
| Exact Mass | 204.15100 |
| PSA | 20.23000 |
| LogP | 3.38610 |
| InChIKey | DEGWYRSBNNCEDW-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCc1ccc(CO)c(C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[2-methyl-4-(4-... CAS#:61447-99-2 |
| Literature: Thomas,A.F.; Guntz-Dubini,R. Helvetica Chimica Acta, 1976 , vol. 59, # 6 p. 2261 - 2267 |
|
~%
[2-methyl-4-(4-... CAS#:61447-99-2 |
| Literature: Thomas,A.F.; Guntz-Dubini,R. Helvetica Chimica Acta, 1976 , vol. 59, # 6 p. 2261 - 2267 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol? |
| A: Molecular weight of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol is 204.30800. |
| Q: What is the CAS number of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol? |
| A: CAS number of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol is 61447-99-2. |
| Q: What is the LogP of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol? |
| A: LogP of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol is 3.38610. |
| Q: What is the InChIKey of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol? |
| A: InChIKey of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol is DEGWYRSBNNCEDW-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol? |
| A: Polar surface area (PSA) of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol is 20.23000. |
| Q: What is the Chinese name of 61447-99-2? |
| A: Chinese name of 61447-99-2 is 61447-99-2. |
| Q: What is the English name of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol? |
| A: The English name of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol is [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol. |
| Q: What is the molecular formula of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol? |
| A: Molecular formula of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol is C14H20O. |
| Q: What is the SMILES notation of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol? |
| A: SMILES notation of [2-methyl-4-(4-methylpent-3-enyl)phenyl]methanol is CC(C)=CCCc1ccc(CO)c(C)c1. |