5-(2-ethoxy-2-phenylethyl)-3-methyl-1,2-oxazole structure
|
Common Name | 5-(2-ethoxy-2-phenylethyl)-3-methyl-1,2-oxazole | ||
|---|---|---|---|---|
| CAS Number | 61449-16-9 | Molecular Weight | 231.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-ethoxy-2-phenylethyl)-3-methyl-1,2-oxazole |
|---|
| Molecular Formula | C14H17NO2 |
|---|---|
| Molecular Weight | 231.29000 |
| Exact Mass | 231.12600 |
| PSA | 35.26000 |
| LogP | 3.30330 |
| InChIKey | GPJBFDBHVLBHNT-UHFFFAOYSA-N |
| SMILES | CCOC(Cc1cc(C)no1)c1ccccc1 |
|
~%
5-(2-ethoxy-2-p... CAS#:61449-16-9 |
| Literature: Kashima,C. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 2254 - 2258 |