methyl 6-(4-phenylphenyl)hexanoate
Modify Date: 2025-08-20 17:48:40
methyl 6-(4-phenylphenyl)hexanoate structure
|
Common Name | methyl 6-(4-phenylphenyl)hexanoate | ||
|---|---|---|---|---|
| CAS Number | 61454-91-9 | Molecular Weight | 282.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 6-(4-phenylphenyl)hexanoate |
|---|
| Molecular Formula | C19H22O2 |
|---|---|
| Molecular Weight | 282.37700 |
| Exact Mass | 282.16200 |
| PSA | 26.30000 |
| LogP | 4.62950 |
| InChIKey | ODXBGVRXSJTAON-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCc1ccc(-c2ccccc2)cc1 |
|
~%
methyl 6-(4-phe... CAS#:61454-91-9 |
| Literature: Boots; Guyer; Marecki Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 9 p. 1374 - 1380 |
|
~%
methyl 6-(4-phe... CAS#:61454-91-9 |
| Literature: Boots; Guyer; Marecki Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 9 p. 1374 - 1380 |
