N-(2,4-dimethyl-4-phenylpentan-2-yl)formamide structure
|
Common Name | N-(2,4-dimethyl-4-phenylpentan-2-yl)formamide | ||
|---|---|---|---|---|
| CAS Number | 61455-14-9 | Molecular Weight | 219.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4-dimethyl-4-phenylpentan-2-yl)formamide |
|---|
| Molecular Formula | C14H21NO |
|---|---|
| Molecular Weight | 219.32300 |
| Exact Mass | 219.16200 |
| PSA | 32.59000 |
| LogP | 3.71920 |
| InChIKey | XYHLZTWLQVRVOP-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(C)(C)c1ccccc1)NC=O |
|
~72%
N-(2,4-dimethyl... CAS#:61455-14-9 |
| Literature: Timberlake, Jack W.; Alender, Jeff; Garner, Archie W.; Hodges, Melvin L.; Oezmeral, Cenan; et al. Journal of Organic Chemistry, 1981 , vol. 46, # 10 p. 2082 - 2089 |
|
~%
N-(2,4-dimethyl... CAS#:61455-14-9 |
| Literature: Prochazka,M. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 1557 - 1564 |