2-[(Z)-(3-methyl-4-oxonaphthalen-1-ylidene)amino]oxyacetic acid structure
|
Common Name | 2-[(Z)-(3-methyl-4-oxonaphthalen-1-ylidene)amino]oxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 6146-99-2 | Molecular Weight | 245.23100 | |
| Density | N/A | Boiling Point | 473.7ºC at 760mmHg | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.3ºC | |
| Name | 2-[(Z)-(3-methyl-4-oxonaphthalen-1-ylidene)amino]oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 473.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23100 |
| Flash Point | 240.3ºC |
| Exact Mass | 245.06900 |
| PSA | 75.96000 |
| LogP | 1.63450 |
| InChIKey | JBOOHWBSLUXBQW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NOCC(=O)O)c2ccccc2C1=O |
|
~%
2-[(Z)-(3-methy... CAS#:6146-99-2 |
| Literature: Holland; Robinson Journal of the Chemical Society, 1948 , p. 182,185 |
| (3-Methyl-4-oxo-4H-[1]naphthylidenaminooxy)-essigsaeure |
| Acetic acid,(((3-methyl-4-oxo-1(4H)-naphthalenylidene)amino)oxy) |
| (3-methyl-4-oxo-4H-[1]naphthylidenaminooxy)-acetic acid |
| Menadoxime [BAN] |
| Carboxymethylmenadione monoxime |
| Acetic acid,(((3-methyl-4-oxo-1(4H)-naphthylidene)amino)oxy) |
| UNII-0UQZ6GMA89 |