2-amino-5H-chromeno[4,3-d]pyrimidin-5-ol structure
|
Common Name | 2-amino-5H-chromeno[4,3-d]pyrimidin-5-ol | ||
|---|---|---|---|---|
| CAS Number | 61466-24-8 | Molecular Weight | 215.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-5H-chromeno[4,3-d]pyrimidin-5-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9N3O2 |
|---|---|
| Molecular Weight | 215.20800 |
| Exact Mass | 215.06900 |
| PSA | 81.99000 |
| LogP | 1.03920 |
| InChIKey | WAZVAFGPLLQIQQ-UHFFFAOYSA-N |
| SMILES | Nc1ncc2c(n1)-c1ccccc1OC2O |
|
~67%
2-amino-5H-chro... CAS#:61466-24-8 |
| Literature: Ghosh, Chandra Kanta; Bandyopadhyay, Chandrakanta; Morin, Christophe Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 1989 - 1994 |
|
~%
2-amino-5H-chro... CAS#:61466-24-8 |
| Literature: Ghosh, Chandra Kanta; Bandyopadhyay, Chandrakanta; Morin, Christophe Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 1989 - 1994 |
| F3099-0200 |
| pyrimidin |