butyl 3-trichlorostannylpropanoate structure
|
Common Name | butyl 3-trichlorostannylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 61470-34-6 | Molecular Weight | 354.23700 | |
| Density | N/A | Boiling Point | 329.4ºC at 760 mmHg | |
| Molecular Formula | C7H13Cl3O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153ºC | |
| Name | butyl 3-trichlorostannylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 329.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H13Cl3O2Sn |
| Molecular Weight | 354.23700 |
| Flash Point | 153ºC |
| Exact Mass | 353.90000 |
| PSA | 26.30000 |
| InChIKey | KKIZJTLMVRCRAA-UHFFFAOYSA-K |
| SMILES | CCCCOC(=O)CC[Sn](Cl)(Cl)Cl |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-n-butoxycarbonylethyltin trichloride |