ethyl 2-hydroxy-4-oxo-6,7,8,9-tetrahydroquinolizine-1-carboxylate structure
|
Common Name | ethyl 2-hydroxy-4-oxo-6,7,8,9-tetrahydroquinolizine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 61486-97-3 | Molecular Weight | 237.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-hydroxy-4-oxo-6,7,8,9-tetrahydroquinolizine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO4 |
|---|---|
| Molecular Weight | 237.25200 |
| Exact Mass | 237.10000 |
| PSA | 68.53000 |
| LogP | 1.06690 |
| InChIKey | LYYSCZGEBOMJCY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(O)cc(=O)n2c1CCCC2 |
| HS Code | 2918990090 |
|---|
|
~%
ethyl 2-hydroxy... CAS#:61486-97-3 |
| Literature: Cheng, Ying; Yang, Hai-Bo; Huang, Zhi-Tang; Wang, Mei-Xiang Tetrahedron Letters, 2001 , vol. 42, # 9 p. 1757 - 1759 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 8-hydroxy-6-oxo-1,3,4,6-tetrahydro-2H-9-quinolizinecarboxylate |
| Ethyl 4-hydroxy-2-oxo-6,7,8,9-tetrahydroquinolizine-1-carboxylate |
| 2-hydroxy-4-oxo-6,7,8,9-tetrahydro-4H-quinolizine-1-carboxylic acid ethyl ester |
| 2H-Quinolizine-9-carboxylic acid,1,3,4,6-tetrahydro-8-hydroxy-6-oxo-,ethyl ester |