1-chloro-4-nitronaphthalene-2-carbonitrile
1-chloro-4-nitronaphthalene-2-carbonitrile structure
|
Common Name | 1-chloro-4-nitronaphthalene-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 61499-37-4 | Molecular Weight | 232.62300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H5ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-4-nitronaphthalene-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H5ClN2O2 |
|---|---|
| Molecular Weight | 232.62300 |
| Exact Mass | 232.00400 |
| PSA | 69.61000 |
| LogP | 3.79628 |
| InChIKey | FTFJZWNSQLNXMX-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])c2ccccc2c1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-chloro-4-nitr... CAS#:61499-37-4 |
| Literature: Sekiguchi,S. et al. Journal of Organic Chemistry, 1979 , vol. 44, p. 3921 - 3925 |
|
~%
1-chloro-4-nitr... CAS#:61499-37-4 |
| Literature: Sekiguchi,S. et al. Journal of Organic Chemistry, 1979 , vol. 44, p. 3921 - 3925 |
![1-hydroxy-4-nitro-[2]naphthoic acid structure](https://image.chemsrc.com/caspic/430/71436-06-1.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Naphthalenecarbonitrile,1-chloro-4-nitro |
| 1-Chlor-2-cyano-4-nitro-naphthalen |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1-chloro-4-nitronaphthalene-2-carbonitrile have? |
| A: English synonyms of 1-chloro-4-nitronaphthalene-2-carbonitrile: 2-Naphthalenecarbonitrile,1-chloro-4-nitro, 1-Chlor-2-cyano-4-nitro-naphthalen. |
| Q: What is the Chinese name of 61499-37-4? |
| A: Chinese name of 61499-37-4 is 61499-37-4. |
| Q: What is the InChIKey of 1-chloro-4-nitronaphthalene-2-carbonitrile? |
| A: InChIKey of 1-chloro-4-nitronaphthalene-2-carbonitrile is FTFJZWNSQLNXMX-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-chloro-4-nitronaphthalene-2-carbonitrile? |
| A: LogP of 1-chloro-4-nitronaphthalene-2-carbonitrile is 3.79628. |
| Q: What is the polar surface area (PSA) of 1-chloro-4-nitronaphthalene-2-carbonitrile? |
| A: Polar surface area (PSA) of 1-chloro-4-nitronaphthalene-2-carbonitrile is 69.61000. |
| Q: What is the CAS number of 1-chloro-4-nitronaphthalene-2-carbonitrile? |
| A: CAS number of 1-chloro-4-nitronaphthalene-2-carbonitrile is 61499-37-4. |
| Q: What is the molecular weight of 1-chloro-4-nitronaphthalene-2-carbonitrile? |
| A: Molecular weight of 1-chloro-4-nitronaphthalene-2-carbonitrile is 232.62300. |
| Q: What is the English name of 1-chloro-4-nitronaphthalene-2-carbonitrile? |
| A: The English name of 1-chloro-4-nitronaphthalene-2-carbonitrile is 1-chloro-4-nitronaphthalene-2-carbonitrile. |
| Q: What is the SMILES notation of 1-chloro-4-nitronaphthalene-2-carbonitrile? |
| A: SMILES notation of 1-chloro-4-nitronaphthalene-2-carbonitrile is N#Cc1cc([N+](=O)[O-])c2ccccc2c1Cl. |
| Q: What is the molecular formula of 1-chloro-4-nitronaphthalene-2-carbonitrile? |
| A: Molecular formula of 1-chloro-4-nitronaphthalene-2-carbonitrile is C11H5ClN2O2. |