[dimethyl(phenyl)silyl]-ethenyl-dimethylsilane
![[dimethyl(phenyl)silyl]-ethenyl-dimethylsilane Structure](https://image.chemsrc.com/caspic/460/61499-43-2.png)
[dimethyl(phenyl)silyl]-ethenyl-dimethylsilane structure
|
Common Name | [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 61499-43-2 | Molecular Weight | 220.45800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20Si2 |
|---|---|
| Molecular Weight | 220.45800 |
| Exact Mass | 220.11000 |
| LogP | 3.11400 |
| InChIKey | MGIXDIZYSQAUDM-UHFFFAOYSA-N |
| SMILES | C=C[Si](C)(C)[Si](C)(C)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[dimethyl(pheny... CAS#:61499-43-2 |
| Literature: Sheludyakov,V.D. et al. J. Gen. Chem. USSR (Engl. Transl.), 1979 , vol. 49, p. 1051 - 1054,912 - 915 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,2,2-Tetramethyl-1-phenyl-2-vinyldisilan |
| Tetramethyl-1-phenyl-2-vinyldisilan |
| Disilane,1-ethenyl-1,1,2,2-tetramethyl-2-phenyl |
| 1,1,2,2-tetramethyl-1-phenyl-2-vinyl-disilane |
| 1-Phenyl-2-vinyltetramethyldisilan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane? |
| A: The English name of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane is [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane. |
| Q: What is the molecular weight of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane? |
| A: Molecular weight of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane is 220.45800. |
| Q: What is the SMILES notation of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane? |
| A: SMILES notation of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane is C=C[Si](C)(C)[Si](C)(C)c1ccccc1. |
| Q: What English synonyms does [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane have? |
| A: English synonyms of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane: 1,1,2,2-Tetramethyl-1-phenyl-2-vinyldisilan, Tetramethyl-1-phenyl-2-vinyldisilan, Disilane,1-ethenyl-1,1,2,2-tetramethyl-2-phenyl, 1,1,2,2-tetramethyl-1-phenyl-2-vinyl-disilane, 1-Phenyl-2-vinyltetramethyldisilan. |
| Q: What is the CAS number of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane? |
| A: CAS number of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane is 61499-43-2. |
| Q: What is the LogP of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane? |
| A: LogP of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane is 3.11400. |
| Q: What is the Chinese name of 61499-43-2? |
| A: Chinese name of 61499-43-2 is 61499-43-2. |
| Q: What is the molecular formula of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane? |
| A: Molecular formula of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane is C12H20Si2. |
| Q: What is the InChIKey of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane? |
| A: InChIKey of [dimethyl(phenyl)silyl]-ethenyl-dimethylsilane is MGIXDIZYSQAUDM-UHFFFAOYSA-N. |