bis(phenylselanyl)silane structure
|
Common Name | bis(phenylselanyl)silane | ||
|---|---|---|---|---|
| CAS Number | 61501-47-1 | Molecular Weight | 342.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12Se2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(phenylselanyl)silane |
|---|
| Molecular Formula | C12H12Se2Si |
|---|---|
| Molecular Weight | 342.22900 |
| Exact Mass | 343.90400 |
| LogP | 0.04460 |
| InChIKey | BMFYWSNUUBXDHP-UHFFFAOYSA-N |
| SMILES | c1ccc([Se][SiH2][Se]c2ccccc2)cc1 |
|
~%
bis(phenylselan... CAS#:61501-47-1 |
| Literature: Drake,J.E.; Hemmings,R.T. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1976 , p. 1730 - 1734 |