1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione
![1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione Structure](https://image.chemsrc.com/caspic/264/61509-75-9.png)
1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione structure
|
Common Name | 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 61509-75-9 | Molecular Weight | 266.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H10O4 |
|---|---|
| Molecular Weight | 266.24800 |
| Exact Mass | 266.05800 |
| PSA | 55.90000 |
| LogP | 1.89100 |
| InChIKey | QQAMHDNEZQSFFE-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2(c3ccccc3)OC12c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Diphenylepoxymaleinsaeureanhydrid |
| epoxydiphenylsuccinic anhydride |
| 2,3-diphenyl-oxirane-2,3-dicarboxylic acid anhydride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione? |
| A: Polar surface area (PSA) of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is 55.90000. |
| Q: What English synonyms does 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione have? |
| A: English synonyms of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione: Diphenylepoxymaleinsaeureanhydrid, epoxydiphenylsuccinic anhydride, 2,3-diphenyl-oxirane-2,3-dicarboxylic acid anhydride. |
| Q: What is the LogP of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione? |
| A: LogP of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is 1.89100. |
| Q: What is the English name of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione? |
| A: The English name of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione. |
| Q: What is the CAS number of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione? |
| A: CAS number of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is 61509-75-9. |
| Q: What is the molecular weight of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione? |
| A: Molecular weight of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is 266.24800. |
| Q: What is the molecular formula of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione? |
| A: Molecular formula of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is C16H10O4. |
| Q: What is the SMILES notation of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione? |
| A: SMILES notation of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is O=C1OC(=O)C2(c3ccccc3)OC12c1ccccc1. |
| Q: What is the Chinese name of 61509-75-9? |
| A: Chinese name of 61509-75-9 is 61509-75-9. |
| Q: What is the InChIKey of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione? |
| A: InChIKey of 1,5-diphenyl-3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is QQAMHDNEZQSFFE-UHFFFAOYSA-N. |