lithium,trimethyl(3-trimethylsilylprop-1-enyl)silane structure
|
Common Name | lithium,trimethyl(3-trimethylsilylprop-1-enyl)silane | ||
|---|---|---|---|---|
| CAS Number | 61518-50-1 | Molecular Weight | 192.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H21LiSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | lithium,trimethyl(3-trimethylsilylprop-1-enyl)silane |
|---|
| Molecular Formula | C9H21LiSi2 |
|---|---|
| Molecular Weight | 192.37500 |
| Exact Mass | 192.13400 |
| LogP | 3.14210 |
| InChIKey | KEPDKACSMRCRME-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C=C[CH-][Si](C)(C)C.[Li+] |
|
~%
lithium,trimeth... CAS#:61518-50-1 |
| Literature: Carter, Martin J.; Fleming, Ian; Percival, Alan Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2415 - 2434 |