P-P-P-dUrd.Na+
Modify Date: 2026-09-13 08:21:29
P-P-P-dUrd.Na+ structure
|
Common Name | P-P-P-dUrd.Na+ | ||
|---|---|---|---|---|
| CAS Number | 6152-08-5 | Molecular Weight | 490.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N2NaO14P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | P-P-P-dUrd.Na+ |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N2NaO14P3 |
|---|---|
| Molecular Weight | 490.12 |
| InChIKey | WQUNVOGLTOFDPT-OERIEOFYSA-M |
| SMILES | O=c1ccn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)([O-])O)O2)c(=O)[nH]1.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 6152-08-5? |
| A: Chinese name of 6152-08-5 is 6152-08-5. |
| Q: What is the CAS number of P-P-P-dUrd.Na+? |
| A: CAS number of P-P-P-dUrd.Na+ is 6152-08-5. |
| Q: What is the SMILES notation of P-P-P-dUrd.Na+? |
| A: SMILES notation of P-P-P-dUrd.Na+ is O=c1ccn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)([O-])O)O2)c(=O)[nH]1.[Na+]. |
| Q: What is the InChIKey of P-P-P-dUrd.Na+? |
| A: InChIKey of P-P-P-dUrd.Na+ is WQUNVOGLTOFDPT-OERIEOFYSA-M. |
| Q: What is the molecular weight of P-P-P-dUrd.Na+? |
| A: Molecular weight of P-P-P-dUrd.Na+ is 490.12. |
| Q: What is the English name of P-P-P-dUrd.Na+? |
| A: The English name of P-P-P-dUrd.Na+ is P-P-P-dUrd.Na+. |
| Q: What is the molecular formula of P-P-P-dUrd.Na+? |
| A: Molecular formula of P-P-P-dUrd.Na+ is C9H14N2NaO14P3. |