ethyl 4-(3-methoxyphenyl)-6-oxopiperidine-3-carboxylate structure
|
Common Name | ethyl 4-(3-methoxyphenyl)-6-oxopiperidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 61527-86-4 | Molecular Weight | 277.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(3-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
|---|
| Molecular Formula | C15H19NO4 |
|---|---|
| Molecular Weight | 277.31600 |
| Exact Mass | 277.13100 |
| PSA | 68.12000 |
| LogP | 1.75390 |
| InChIKey | YSTPEYPMIFEDAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNC(=O)CC1c1cccc(OC)c1 |
|
~%
ethyl 4-(3-meth... CAS#:61527-86-4 |
| Literature: The United States of America as represented by the Department of Health and Human Services Patent: US4289882 A1, 1981 ; |