(1-cyano-2-phenylethyl) N,N-dimethylcarbamodithioate structure
|
Common Name | (1-cyano-2-phenylethyl) N,N-dimethylcarbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 61540-40-7 | Molecular Weight | 250.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-cyano-2-phenylethyl) N,N-dimethylcarbamodithioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14N2S2 |
|---|---|
| Molecular Weight | 250.38300 |
| Exact Mass | 250.06000 |
| PSA | 84.42000 |
| LogP | 2.70098 |
| InChIKey | RGDDGKJATYDKQN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)SC(C#N)Cc1ccccc1 |
|
~79%
(1-cyano-2-phen... CAS#:61540-40-7 |
| Literature: Yanagawa, Makato; Moriya, Osamu; Watanabe, Yoshihiko; Ueno, Yoshio; Endo, Takeshi Bulletin of the Chemical Society of Japan, 1988 , vol. 61, p. 2203 - 2204 |
| Carbamodithioic acid,dimethyl-,1-cyano-2-phenylethyl ester |