4-[(2,4-dimethoxyphenyl)azo]-2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one structure
|
Common Name | 4-[(2,4-dimethoxyphenyl)azo]-2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 61550-72-9 | Molecular Weight | 338.36100 | |
| Density | 1.25g/cm3 | Boiling Point | 541.9ºC at 760 mmHg | |
| Molecular Formula | C18H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.5ºC | |
| Name | 4-[(2,4-dimethoxyphenyl)diazenyl]-5-methyl-2-phenyl-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 541.9ºC at 760 mmHg |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.36100 |
| Flash Point | 281.5ºC |
| Exact Mass | 338.13800 |
| PSA | 75.85000 |
| LogP | 3.07940 |
| Index of Refraction | 1.615 |
| InChIKey | BDPUFQZQVPHSCM-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=NC2C(=O)N(c3ccccc3)N=C2C)c(OC)c1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 262-838-5 |