ethyl prop-2-enoate,methyl 2-methylprop-2-enoate,prop-2-enyl 2-methylprop-2-enoate structure
|
Common Name | ethyl prop-2-enoate,methyl 2-methylprop-2-enoate,prop-2-enyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 61553-03-5 | Molecular Weight | 326.38500 | |
| Density | N/A | Boiling Point | 138.6ºC at 760mmHg | |
| Molecular Formula | C17H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 33.9ºC | |
| Name | ethyl prop-2-enoate,methyl 2-methylprop-2-enoate,prop-2-enyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 138.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.38500 |
| Flash Point | 33.9ºC |
| Exact Mass | 326.17300 |
| PSA | 78.90000 |
| LogP | 2.76270 |
| InChIKey | AHDMERQHOSVRKV-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)OCC.C=CCOC(=O)C(=C)C |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with ethyl 2-propenoate and 2-propen-1-yl 2-methyl-2-propenoate |
| Allyl methacrylate,ethyl acrylate,methyl methacrylate polymer |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with ethyl 2-propenoate and 2-propenyl 2-methyl-2-propenoate |