1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone structure
|
Common Name | 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 61563-45-9 | Molecular Weight | 244.11700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is 7,8-二氯-2-乙酰基-3,4-二氢异喹啉, with CAS number 61563-45-9, molecular formula C11H11Cl2NO, and molecular weight 244.11700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11Cl2NO |
|---|---|
| Molecular Weight | 244.11700 |
| Exact Mass | 243.02200 |
| PSA | 20.31000 |
| LogP | 2.83590 |
| InChIKey | PSQATYDOUXPBMP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCc2ccc(Cl)c(Cl)c2C1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933499090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Isoquinoline,2-acetyl-7,8-dichloro-1,2,3,4-tetrahydro |
| 2-acetyl-7,8-dichloro-1,2,3,4-tetrahydroisoquinoline |
| N-acetyl-7,8-dichloro-1,2,3,4-tetrahydroisoquinoline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone? |
| A: Molecular weight of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is 244.11700. |
| Q: What is the SMILES notation of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone? |
| A: SMILES notation of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is CC(=O)N1CCc2ccc(Cl)c(Cl)c2C1. |
| Q: What is the InChIKey of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone? |
| A: InChIKey of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is PSQATYDOUXPBMP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone? |
| A: Polar surface area (PSA) of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is 20.31000. |
| Q: What is the Chinese name of 61563-45-9? |
| A: Chinese name of 61563-45-9 is 61563-45-9. |
| Q: What is the molecular formula of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone? |
| A: Molecular formula of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is C11H11Cl2NO. |
| Q: What English synonyms does 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone have? |
| A: English synonyms of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone: Isoquinoline,2-acetyl-7,8-dichloro-1,2,3,4-tetrahydro, 2-acetyl-7,8-dichloro-1,2,3,4-tetrahydroisoquinoline, N-acetyl-7,8-dichloro-1,2,3,4-tetrahydroisoquinoline. |
| Q: What is the LogP of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone? |
| A: LogP of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is 2.83590. |
| Q: What is the CAS number of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone? |
| A: CAS number of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is 61563-45-9. |
| Q: What is the English name of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone? |
| A: The English name of 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone is 1-(7,8-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)ethanone. |