4-[benzenesulfonyl(phenyl)methyl]phenol
![4-[benzenesulfonyl(phenyl)methyl]phenol Structure](https://image.chemsrc.com/caspic/013/61563-83-5.png)
4-[benzenesulfonyl(phenyl)methyl]phenol structure
|
Common Name | 4-[benzenesulfonyl(phenyl)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 61563-83-5 | Molecular Weight | 324.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-[benzenesulfonyl(phenyl)methyl]phenol (Chinese name: 4-苯基苯甲酰基苯酚, CAS number: 61563-83-5, molecular formula: C19H16O3S, molecular weight: 324.39400), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[benzenesulfonyl(phenyl)methyl]phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H16O3S |
|---|---|
| Molecular Weight | 324.39400 |
| Exact Mass | 324.08200 |
| PSA | 62.75000 |
| LogP | 5.03630 |
| InChIKey | MNRHJELOLWPBSL-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(c1ccccc1)c1ccc(O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-[benzenesulfo... CAS#:61563-83-5 |
| Literature: Koutek,B. et al. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 2250 - 2255 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-[benzenesulfonyl(phenyl)methyl]phenol? |
| A: InChIKey of 4-[benzenesulfonyl(phenyl)methyl]phenol is MNRHJELOLWPBSL-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-[benzenesulfonyl(phenyl)methyl]phenol? |
| A: LogP of 4-[benzenesulfonyl(phenyl)methyl]phenol is 5.03630. |
| Q: What is the English name of 4-[benzenesulfonyl(phenyl)methyl]phenol? |
| A: The English name of 4-[benzenesulfonyl(phenyl)methyl]phenol is 4-[benzenesulfonyl(phenyl)methyl]phenol. |
| Q: What is the molecular weight of 4-[benzenesulfonyl(phenyl)methyl]phenol? |
| A: Molecular weight of 4-[benzenesulfonyl(phenyl)methyl]phenol is 324.39400. |
| Q: What is the polar surface area (PSA) of 4-[benzenesulfonyl(phenyl)methyl]phenol? |
| A: Polar surface area (PSA) of 4-[benzenesulfonyl(phenyl)methyl]phenol is 62.75000. |
| Q: What is the molecular formula of 4-[benzenesulfonyl(phenyl)methyl]phenol? |
| A: Molecular formula of 4-[benzenesulfonyl(phenyl)methyl]phenol is C19H16O3S. |
| Q: What is the SMILES notation of 4-[benzenesulfonyl(phenyl)methyl]phenol? |
| A: SMILES notation of 4-[benzenesulfonyl(phenyl)methyl]phenol is O=S(=O)(c1ccccc1)C(c1ccccc1)c1ccc(O)cc1. |
| Q: What is the CAS number of 4-[benzenesulfonyl(phenyl)methyl]phenol? |
| A: CAS number of 4-[benzenesulfonyl(phenyl)methyl]phenol is 61563-83-5. |
| Q: What is the Chinese name of 61563-83-5? |
| A: Chinese name of 61563-83-5 is 61563-83-5. |