4-(benzenesulfonylmethyl)-2,6-dimethylphenol
4-(benzenesulfonylmethyl)-2,6-dimethylphenol structure
|
Common Name | 4-(benzenesulfonylmethyl)-2,6-dimethylphenol | ||
|---|---|---|---|---|
| CAS Number | 61563-84-6 | Molecular Weight | 276.35100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-(benzenesulfonylmethyl)-2,6-dimethylphenol, Chinese name: 对-(苯基磺甲基)-2,6-二甲基苯酚, CAS number: 61563-84-6, molecular formula: C15H16O3S, molecular weight: 276.35100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(benzenesulfonylmethyl)-2,6-dimethylphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16O3S |
|---|---|
| Molecular Weight | 276.35100 |
| Exact Mass | 276.08200 |
| PSA | 62.75000 |
| LogP | 4.06370 |
| InChIKey | GYKKIRDWZNHVQU-UHFFFAOYSA-N |
| SMILES | Cc1cc(CS(=O)(=O)c2ccccc2)cc(C)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(benzenesulfo... CAS#:61563-84-6 |
| Literature: Koutek,B. et al. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 2250 - 2255 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol? |
| A: Molecular formula of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol is C15H16O3S. |
| Q: What is the CAS number of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol? |
| A: CAS number of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol is 61563-84-6. |
| Q: What is the molecular weight of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol? |
| A: Molecular weight of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol is 276.35100. |
| Q: What is the SMILES notation of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol? |
| A: SMILES notation of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol is Cc1cc(CS(=O)(=O)c2ccccc2)cc(C)c1O. |
| Q: What is the polar surface area (PSA) of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol? |
| A: Polar surface area (PSA) of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol is 62.75000. |
| Q: What is the Chinese name of 61563-84-6? |
| A: Chinese name of 61563-84-6 is 61563-84-6. |
| Q: What is the InChIKey of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol? |
| A: InChIKey of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol is GYKKIRDWZNHVQU-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol? |
| A: The English name of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol is 4-(benzenesulfonylmethyl)-2,6-dimethylphenol. |
| Q: What is the LogP of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol? |
| A: LogP of 4-(benzenesulfonylmethyl)-2,6-dimethylphenol is 4.06370. |