4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol
![4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol Structure](https://image.chemsrc.com/caspic/437/61563-85-7.png)
4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol structure
|
Common Name | 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 61563-85-7 | Molecular Weight | 322.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-(1-(benzenesulfonyl)ethyl)-2,6-dimethoxyphenol, Chinese name unavailable, CAS number 61563-85-7, molecular formula C16H18O5S, molecular weight 322.37600, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18O5S |
|---|---|
| Molecular Weight | 322.37600 |
| Exact Mass | 322.08700 |
| PSA | 81.21000 |
| LogP | 4.02510 |
| InChIKey | YVUPQJPGZXWHJJ-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)S(=O)(=O)c2ccccc2)cc(OC)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-[1-(benzenesu... CAS#:61563-85-7 |
| Literature: Koutek,B. et al. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 2250 - 2255 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol? |
| A: Polar surface area (PSA) of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol is 81.21000. |
| Q: What is the English name of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol? |
| A: The English name of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol is 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol. |
| Q: What is the molecular weight of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol? |
| A: Molecular weight of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol is 322.37600. |
| Q: What is the Chinese name of 61563-85-7? |
| A: Chinese name of 61563-85-7 is 61563-85-7. |
| Q: What is the CAS number of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol? |
| A: CAS number of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol is 61563-85-7. |
| Q: What is the molecular formula of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol? |
| A: Molecular formula of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol is C16H18O5S. |
| Q: What is the SMILES notation of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol? |
| A: SMILES notation of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol is COc1cc(C(C)S(=O)(=O)c2ccccc2)cc(OC)c1O. |
| Q: What is the LogP of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol? |
| A: LogP of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol is 4.02510. |
| Q: What is the InChIKey of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol? |
| A: InChIKey of 4-[1-(benzenesulfonyl)ethyl]-2,6-dimethoxyphenol is YVUPQJPGZXWHJJ-UHFFFAOYSA-N. |