4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol
![4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol Structure](https://image.chemsrc.com/caspic/399/61563-86-8.png)
4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol structure
|
Common Name | 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 61563-86-8 | Molecular Weight | 384.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol, Chinese name: 4-苯基苯甲酰基甲基-2,6-二甲氧基苯酚, CAS number: 61563-86-8, molecular formula: C21H20O5S, molecular weight: 384.44600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H20O5S |
|---|---|
| Molecular Weight | 384.44600 |
| Exact Mass | 384.10300 |
| PSA | 81.21000 |
| LogP | 5.05350 |
| InChIKey | SKCCSGQYDUTLTE-UHFFFAOYSA-N |
| SMILES | COc1cc(C(c2ccccc2)S(=O)(=O)c2ccccc2)cc(OC)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-[benzenesulfo... CAS#:61563-86-8 |
| Literature: Koutek,B. et al. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 2250 - 2255 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol? |
| A: InChIKey of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol is SKCCSGQYDUTLTE-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol? |
| A: Polar surface area (PSA) of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol is 81.21000. |
| Q: What is the molecular weight of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol? |
| A: Molecular weight of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol is 384.44600. |
| Q: What is the molecular formula of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol? |
| A: Molecular formula of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol is C21H20O5S. |
| Q: What is the CAS number of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol? |
| A: CAS number of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol is 61563-86-8. |
| Q: What is the LogP of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol? |
| A: LogP of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol is 5.05350. |
| Q: What is the Chinese name of 61563-86-8? |
| A: Chinese name of 61563-86-8 is 61563-86-8. |
| Q: What is the English name of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol? |
| A: The English name of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol is 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol. |
| Q: What is the SMILES notation of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol? |
| A: SMILES notation of 4-[benzenesulfonyl(phenyl)methyl]-2,6-dimethoxyphenol is COc1cc(C(c2ccccc2)S(=O)(=O)c2ccccc2)cc(OC)c1O. |