4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol
![4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol Structure](https://image.chemsrc.com/caspic/361/61563-87-9.png)
4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol structure
|
Common Name | 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 61563-87-9 | Molecular Weight | 408.55300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol (CAS: 61563-87-9), molecular formula C25H28O3S, molecular weight 408.55300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H28O3S |
|---|---|
| Molecular Weight | 408.55300 |
| Exact Mass | 408.17600 |
| PSA | 62.75000 |
| LogP | 7.28310 |
| InChIKey | DZVFAAWGVGJWEK-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(c2ccccc2)S(=O)(=O)c2ccccc2)cc(C(C)C)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol? |
| A: Polar surface area (PSA) of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol is 62.75000. |
| Q: What is the LogP of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol? |
| A: LogP of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol is 7.28310. |
| Q: What is the molecular formula of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol? |
| A: Molecular formula of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol is C25H28O3S. |
| Q: What is the English name of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol? |
| A: The English name of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol is 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol. |
| Q: What is the SMILES notation of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol? |
| A: SMILES notation of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol is CC(C)c1cc(C(c2ccccc2)S(=O)(=O)c2ccccc2)cc(C(C)C)c1O. |
| Q: What is the InChIKey of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol? |
| A: InChIKey of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol is DZVFAAWGVGJWEK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol? |
| A: Molecular weight of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol is 408.55300. |
| Q: What is the Chinese name of 61563-87-9? |
| A: Chinese name of 61563-87-9 is 61563-87-9. |
| Q: What is the CAS number of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol? |
| A: CAS number of 4-[benzenesulfonyl(phenyl)methyl]-2,6-di(propan-2-yl)phenol is 61563-87-9. |