6-oxidobenzo[f][1,7]naphthyridin-6-ium
![6-oxidobenzo[f][1,7]naphthyridin-6-ium Structure](https://image.chemsrc.com/caspic/088/61564-14-5.png)
6-oxidobenzo[f][1,7]naphthyridin-6-ium structure
|
Common Name | 6-oxidobenzo[f][1,7]naphthyridin-6-ium | ||
|---|---|---|---|---|
| CAS Number | 61564-14-5 | Molecular Weight | 196.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 6-oxidobenzo[f][1,7]naphthyridin-6-ium (CAS号61564-14-5, molecular formula C12H8N2O, molecular weight 196.20500). For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-oxidobenzo[f][1,7]naphthyridin-6-ium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8N2O |
|---|---|
| Molecular Weight | 196.20500 |
| Exact Mass | 196.06400 |
| PSA | 38.35000 |
| LogP | 2.81650 |
| InChIKey | RGPQRYQDLTZUMH-UHFFFAOYSA-N |
| SMILES | [O-][n+]1cc2ncccc2c2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~17%
6-oxidobenzo[f]... CAS#:61564-14-5 |
| Literature: Bachowska; Zujewska Polish Journal of Chemistry, 1998 , vol. 72, # 1 p. 89 - 92 |
![benzo[f][1,7]naphthyridine structure](https://image.chemsrc.com/caspic/332/230-10-4.png)
![Benzo[f][1,7]naphthyridine 4,6-dioxide structure](https://image.chemsrc.com/caspic/050/61564-15-6.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,6-benzo<h>naphthyridine 6-oxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 61564-14-5? |
| A: Chinese name of 61564-14-5 is 61564-14-5. |
| Q: What is the LogP of 6-oxidobenzo[f][1,7]naphthyridin-6-ium? |
| A: LogP of 6-oxidobenzo[f][1,7]naphthyridin-6-ium is 2.81650. |
| Q: What is the English name of 6-oxidobenzo[f][1,7]naphthyridin-6-ium? |
| A: The English name of 6-oxidobenzo[f][1,7]naphthyridin-6-ium is 6-oxidobenzo[f][1,7]naphthyridin-6-ium. |
| Q: What is the molecular formula of 6-oxidobenzo[f][1,7]naphthyridin-6-ium? |
| A: Molecular formula of 6-oxidobenzo[f][1,7]naphthyridin-6-ium is C12H8N2O. |
| Q: What is the polar surface area (PSA) of 6-oxidobenzo[f][1,7]naphthyridin-6-ium? |
| A: Polar surface area (PSA) of 6-oxidobenzo[f][1,7]naphthyridin-6-ium is 38.35000. |
| Q: What is the CAS number of 6-oxidobenzo[f][1,7]naphthyridin-6-ium? |
| A: CAS number of 6-oxidobenzo[f][1,7]naphthyridin-6-ium is 61564-14-5. |
| Q: What is the InChIKey of 6-oxidobenzo[f][1,7]naphthyridin-6-ium? |
| A: InChIKey of 6-oxidobenzo[f][1,7]naphthyridin-6-ium is RGPQRYQDLTZUMH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-oxidobenzo[f][1,7]naphthyridin-6-ium? |
| A: Molecular weight of 6-oxidobenzo[f][1,7]naphthyridin-6-ium is 196.20500. |
| Q: What is the SMILES notation of 6-oxidobenzo[f][1,7]naphthyridin-6-ium? |
| A: SMILES notation of 6-oxidobenzo[f][1,7]naphthyridin-6-ium is [O-][n+]1cc2ncccc2c2ccccc21. |
| Q: What English synonyms does 6-oxidobenzo[f][1,7]naphthyridin-6-ium have? |
| A: English synonyms of 6-oxidobenzo[f][1,7]naphthyridin-6-ium: 4,6-benzonaphthyridine 6-oxide. |