N-ethyl-2,2-diphenyl-acetamide structure
|
Common Name | N-ethyl-2,2-diphenyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 6159-08-6 | Molecular Weight | 239.31200 | |
| Density | 1.063g/cm3 | Boiling Point | 434.4ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263ºC | |
| Name | N-ethyl-2,2-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 434.4ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 263ºC |
| Exact Mass | 239.13100 |
| PSA | 29.10000 |
| LogP | 3.34550 |
| Index of Refraction | 1.563 |
| InChIKey | HKNZSBGYCFOUHB-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-ethyl-2,2-dip... CAS#:6159-08-6 |
| Literature: Komatsu,M. et al. Journal of Organic Chemistry, 1974 , vol. 39, p. 3198 - 3205 |
|
~%
N-ethyl-2,2-dip... CAS#:6159-08-6 |
| Literature: Skinner; Perkins Journal of the American Chemical Society, 1950 , vol. 72, p. 5569,5573 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diphenyl-essigsaeure-aethylamid |
| N-Ethyldiphenylacetamid |
| N-ETHYL-2,2-DIPHENYL-ACETAMIDE |
| diphenyl-acetic acid ethylamide |