Ursodesoxycholic Acid Diformate
Modify Date: 2025-09-14 16:43:01
Ursodesoxycholic Acid Diformate structure
|
Common Name | Ursodesoxycholic Acid Diformate | ||
|---|---|---|---|---|
| CAS Number | 6159-50-8 | Molecular Weight | 448.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H40O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ursodesoxycholic Acid Diformate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H40O6 |
|---|---|
| Molecular Weight | 448.6 |
| InChIKey | LMKQATDCJXKIJD-LBSADWJPSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(OC=O)CC4CC(OC=O)CCC4(C)C3CCC12C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ursodesoxycholic Acid Diformate? |
| A: CAS number of Ursodesoxycholic Acid Diformate is 6159-50-8. |
| Q: What is the molecular weight of Ursodesoxycholic Acid Diformate? |
| A: Molecular weight of Ursodesoxycholic Acid Diformate is 448.6. |
| Q: What is the English name of Ursodesoxycholic Acid Diformate? |
| A: The English name of Ursodesoxycholic Acid Diformate is Ursodesoxycholic Acid Diformate. |
| Q: What is the InChIKey of Ursodesoxycholic Acid Diformate? |
| A: InChIKey of Ursodesoxycholic Acid Diformate is LMKQATDCJXKIJD-LBSADWJPSA-N. |
| Q: What is the molecular formula of Ursodesoxycholic Acid Diformate? |
| A: Molecular formula of Ursodesoxycholic Acid Diformate is C26H40O6. |
| Q: What is the Chinese name of 6159-50-8? |
| A: Chinese name of 6159-50-8 is 6159-50-8. |
| Q: What is the SMILES notation of Ursodesoxycholic Acid Diformate? |
| A: SMILES notation of Ursodesoxycholic Acid Diformate is CC(CCC(=O)O)C1CCC2C3C(OC=O)CC4CC(OC=O)CCC4(C)C3CCC12C. |