Raunescine nitrate
Modify Date: 2026-08-04 20:45:00
Raunescine nitrate structure
|
Common Name | Raunescine nitrate | ||
|---|---|---|---|---|
| CAS Number | 6159-98-4 | Molecular Weight | 628.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H38N3O11+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Raunescine nitrate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H38N3O11+ |
|---|---|
| Molecular Weight | 628.6 |
| InChIKey | GCMJKUFVHLQJEJ-HZGKCDBDSA-N |
| SMILES | COC(=O)C1C(O)C(OC(=O)c2cc(OC)c(OC)c(OC)c2)CC2CN3CCc4c([nH]c5ccccc45)C3CC21.O=[N+](O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Raunescine nitrate? |
| A: Molecular weight of Raunescine nitrate is 628.6. |
| Q: What is the Chinese name of 6159-98-4? |
| A: Chinese name of 6159-98-4 is 6159-98-4. |
| Q: What is the molecular formula of Raunescine nitrate? |
| A: Molecular formula of Raunescine nitrate is C31H38N3O11+. |
| Q: What is the SMILES notation of Raunescine nitrate? |
| A: SMILES notation of Raunescine nitrate is COC(=O)C1C(O)C(OC(=O)c2cc(OC)c(OC)c(OC)c2)CC2CN3CCc4c([nH]c5ccccc45)C3CC21.O=[N+](O)O. |
| Q: What is the English name of Raunescine nitrate? |
| A: The English name of Raunescine nitrate is Raunescine nitrate. |
| Q: What is the CAS number of Raunescine nitrate? |
| A: CAS number of Raunescine nitrate is 6159-98-4. |
| Q: What is the InChIKey of Raunescine nitrate? |
| A: InChIKey of Raunescine nitrate is GCMJKUFVHLQJEJ-HZGKCDBDSA-N. |