tert-butyl 4-hydroxy-3-oxopentanoate
tert-butyl 4-hydroxy-3-oxopentanoate structure
|
Common Name | tert-butyl 4-hydroxy-3-oxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 61603-71-2 | Molecular Weight | 188.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 4-hydroxy-3-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H16O4 |
|---|---|
| Molecular Weight | 188.22100 |
| Exact Mass | 188.10500 |
| PSA | 63.60000 |
| LogP | 0.66810 |
| InChIKey | KNVBWQJWJDAVHM-UHFFFAOYSA-N |
| SMILES | CC(O)C(=O)CC(=O)OC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tert-butyl 4-hy... CAS#:61603-71-2 |
| Literature: Hiyama, Tamejiro; Oishi, Haruhito; Saimoto, Hiroyuki Tetrahedron Letters, 1985 , vol. 26, # 20 p. 2459 - 2462 |
|
~%
tert-butyl 4-hy... CAS#:61603-71-2 |
| Literature: Damon,R.E. et al. Tetrahedron Letters, 1976 , p. 2749 - 2752 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| t-butyl 4-hydroxy-3-oxo-pentanoate |
| Pentanoic acid,4-hydroxy-3-oxo-,1,1-dimethylethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-butyl 4-hydroxy-3-oxopentanoate? |
| A: Molecular weight of tert-butyl 4-hydroxy-3-oxopentanoate is 188.22100. |
| Q: What English synonyms does tert-butyl 4-hydroxy-3-oxopentanoate have? |
| A: English synonyms of tert-butyl 4-hydroxy-3-oxopentanoate: t-butyl 4-hydroxy-3-oxo-pentanoate, Pentanoic acid,4-hydroxy-3-oxo-,1,1-dimethylethyl ester. |
| Q: What is the CAS number of tert-butyl 4-hydroxy-3-oxopentanoate? |
| A: CAS number of tert-butyl 4-hydroxy-3-oxopentanoate is 61603-71-2. |
| Q: What is the LogP of tert-butyl 4-hydroxy-3-oxopentanoate? |
| A: LogP of tert-butyl 4-hydroxy-3-oxopentanoate is 0.66810. |
| Q: What is the English name of tert-butyl 4-hydroxy-3-oxopentanoate? |
| A: The English name of tert-butyl 4-hydroxy-3-oxopentanoate is tert-butyl 4-hydroxy-3-oxopentanoate. |
| Q: What is the molecular formula of tert-butyl 4-hydroxy-3-oxopentanoate? |
| A: Molecular formula of tert-butyl 4-hydroxy-3-oxopentanoate is C9H16O4. |
| Q: What is the SMILES notation of tert-butyl 4-hydroxy-3-oxopentanoate? |
| A: SMILES notation of tert-butyl 4-hydroxy-3-oxopentanoate is CC(O)C(=O)CC(=O)OC(C)(C)C. |
| Q: What is the polar surface area (PSA) of tert-butyl 4-hydroxy-3-oxopentanoate? |
| A: Polar surface area (PSA) of tert-butyl 4-hydroxy-3-oxopentanoate is 63.60000. |
| Q: What is the InChIKey of tert-butyl 4-hydroxy-3-oxopentanoate? |
| A: InChIKey of tert-butyl 4-hydroxy-3-oxopentanoate is KNVBWQJWJDAVHM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 61603-71-2? |
| A: Chinese name of 61603-71-2 is 61603-71-2. |