4-chloro-3-oxo-N-(p-tolyl)butyramide structure
|
Common Name | 4-chloro-3-oxo-N-(p-tolyl)butyramide | ||
|---|---|---|---|---|
| CAS Number | 61610-54-6 | Molecular Weight | 225.67100 | |
| Density | 1.251g/cm3 | Boiling Point | 413.5ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9ºC | |
| Name | 4-chloro-N-(4-methylphenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 413.5ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 203.9ºC |
| Exact Mass | 225.05600 |
| PSA | 46.17000 |
| LogP | 2.20450 |
| Index of Refraction | 1.573 |
| InChIKey | NSNSCJAIRFVCBB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)CC(=O)CCl)cc1 |
|
~%
4-chloro-3-oxo-... CAS#:61610-54-6 |
| Literature: Han, Minsoo; Nam, Kee Dal; Shin, Dongyun; Jeong, Nakcheol; Hahn, Hoh-Gyu Journal of Combinatorial Chemistry, 2010 , vol. 12, # 4 p. 518 - 530 |
| einecs 262-869-4 |