3-(4-methylphenyl)sulfanyl-3-phenyl-2-benzofuran-1-one structure
|
Common Name | 3-(4-methylphenyl)sulfanyl-3-phenyl-2-benzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 61613-18-1 | Molecular Weight | 332.41600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methylphenyl)sulfanyl-3-phenyl-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H16O2S |
|---|---|
| Molecular Weight | 332.41600 |
| Exact Mass | 332.08700 |
| PSA | 51.60000 |
| LogP | 5.15880 |
| InChIKey | WWDRNMORZGROAQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SC2(c3ccccc3)OC(=O)c3ccccc32)cc1 |
|
~86%
3-(4-methylphen... CAS#:61613-18-1 |
| Literature: Takahashi, Masaki; Sekine, Norio; Fujita, Tsutomu; Watanabe, Shoji; Yamaguchi, Kentaro; Sakamoto, Masami Journal of the American Chemical Society, 1998 , vol. 120, # 49 p. 12770 - 12776 |
|
~59%
3-(4-methylphen... CAS#:61613-18-1 |
| Literature: Takahashi, Masaki; Fujita, Tsutomu; Watanabe, Shoji; Sakamoto, Masami Journal of the Chemical Society. Perkin Transactions 2, 1998 , # 3 p. 487 - 491 |
| 3-phenyl-3-p-tolylsulfanyl-3H-isobenzofuran-1-one |