1-(ethyl-heptoxy-phosphoryl)oxyheptane structure
|
Common Name | 1-(ethyl-heptoxy-phosphoryl)oxyheptane | ||
|---|---|---|---|---|
| CAS Number | 6163-81-1 | Molecular Weight | 306.42100 | |
| Density | 0.929g/cm3 | Boiling Point | 379.9ºC at 760 mmHg | |
| Molecular Formula | C16H35O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.1ºC | |
| Name | 1-[ethyl(heptoxy)phosphoryl]oxyheptane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.929g/cm3 |
|---|---|
| Boiling Point | 379.9ºC at 760 mmHg |
| Molecular Formula | C16H35O3P |
| Molecular Weight | 306.42100 |
| Flash Point | 197.1ºC |
| Exact Mass | 306.23200 |
| PSA | 45.34000 |
| LogP | 6.17340 |
| Index of Refraction | 1.438 |
| InChIKey | RBPHHEPCSXTUGB-UHFFFAOYSA-N |
| SMILES | CCCCCCCOP(=O)(CC)OCCCCCCC |
|
~%
1-(ethyl-heptox... CAS#:6163-81-1 |
| Literature: Foxton,A.A. et al. Journal of the Chemical Society [Section] A: Inorganic, Physical, Theoretical, 1966 , p. 249 - 253 |
|
~%
1-(ethyl-heptox... CAS#:6163-81-1 |
| Literature: Foxton,A.A. et al. Journal of the Chemical Society [Section] A: Inorganic, Physical, Theoretical, 1966 , p. 249 - 253 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(ethyl-heptoxy-phosphoryl)oxyheptane |
| Ethylphosphonic acid,diheptyl ester |
| Diheptyl ethylphosphonate |