N-[1-(4-acetylphenyl)propan-2-yl]acetamide structure
|
Common Name | N-[1-(4-acetylphenyl)propan-2-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 61630-03-3 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[1-(4-acetylphenyl)propan-2-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 49.66000 |
| LogP | 2.79660 |
| InChIKey | GFXKTZQLBMPONQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)Cc1ccc(C(C)=O)cc1 |
|
~%
N-[1-(4-acetylp... CAS#:61630-03-3 |
| Literature: Blicke; Lilienfeld Journal of the American Chemical Society, 1943 , vol. 65, p. 2377 |
|
~%
N-[1-(4-acetylp... CAS#:61630-03-3 |
| Literature: Blicke; Lilienfeld Journal of the American Chemical Society, 1943 , vol. 65, p. 2377 |
| N-Acetyl-4-acetyl-amphetamin |