1H-Purine-2,6-dione,3,9-dihydro-8-(1-hydroxyethyl)-1,3-dimethyl- structure
|
Common Name | 1H-Purine-2,6-dione,3,9-dihydro-8-(1-hydroxyethyl)-1,3-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 61639-76-7 | Molecular Weight | 224.21700 | |
| Density | 1.456g/cm3 | Boiling Point | 505.3ºC at 760 mmHg | |
| Molecular Formula | C9H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.4ºC | |
| Name | 8-(1-hydroxyethyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 505.3ºC at 760 mmHg |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.21700 |
| Flash Point | 259.4ºC |
| Exact Mass | 224.09100 |
| PSA | 92.91000 |
| Index of Refraction | 1.622 |
| InChIKey | XXAKXZGZAVVMFX-UHFFFAOYSA-N |
| SMILES | CC(O)c1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
|
~%
1H-Purine-2,6-d... CAS#:61639-76-7 |
| Literature: Murgida, Daniel H.; Aramendia, Pedro F.; Erra-Balsells, Rosa Photochemistry and Photobiology, 1998 , vol. 67, # 5 p. 487 - 494 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |