5(r)-hete structure
|
Common Name | 5(r)-hete | ||
|---|---|---|---|---|
| CAS Number | 61641-47-2 | Molecular Weight | 320.466 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 487.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.8±25.2 °C | |
| Name | 5(r)-hete |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.7±45.0 °C at 760 mmHg |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.466 |
| Flash Point | 262.8±25.2 °C |
| Exact Mass | 320.235138 |
| PSA | 57.53000 |
| LogP | 5.56 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | KGIJOOYOSFUGPC-CABOLEKPSA-N |
| SMILES | CCCCCC=CCC=CCC=CC=CC(O)CCCC(=O)O |
| HS Code | 2918199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (5R,6E,8Z,11Z,14Z)-5-Hydroxy-6,8,11,14-icosatetraenoic acid |
| 5r-hydroxy-6e,8z,11z,14z-eicosatetraenoic acid |