methyl 2-[2-(4-methylphenyl)acetyl]benzoate structure
|
Common Name | methyl 2-[2-(4-methylphenyl)acetyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 61653-01-8 | Molecular Weight | 268.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[2-(4-methylphenyl)acetyl]benzoate |
|---|
| Molecular Formula | C17H16O3 |
|---|---|
| Molecular Weight | 268.30700 |
| Exact Mass | 268.11000 |
| PSA | 43.37000 |
| LogP | 3.20700 |
| InChIKey | MOVPAOGAOPLOLQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1C(=O)Cc1ccc(C)cc1 |
|
~%
methyl 2-[2-(4-... CAS#:61653-01-8 |
| Literature: Bowden, Keith; Chehel-Amiran, Mohsen Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 2031 - 2034 |