(4Z)-5-methyl-4-[(5Z)-5-(3-methyl-5-oxo-1-phenyl-pyrazol-4-ylidene)-1,2,4-trithiolan-3-ylidene]-2-phenyl-pyrazol-3-one structure
|
Common Name | (4Z)-5-methyl-4-[(5Z)-5-(3-methyl-5-oxo-1-phenyl-pyrazol-4-ylidene)-1,2,4-trithiolan-3-ylidene]-2-phenyl-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 61656-33-5 | Molecular Weight | 464.58300 | |
| Density | 1.49g/cm3 | Boiling Point | 494.6ºC at 760 mmHg | |
| Molecular Formula | C22H16N4O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.9ºC | |
| Name | (4E)-5-methyl-4-[(5E)-5-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-1,2,4-trithiolan-3-ylidene]-2-phenylpyrazol-3-one |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 494.6ºC at 760 mmHg |
| Molecular Formula | C22H16N4O2S3 |
| Molecular Weight | 464.58300 |
| Flash Point | 252.9ºC |
| Exact Mass | 464.04400 |
| PSA | 141.24000 |
| LogP | 4.38440 |
| Index of Refraction | 1.775 |
| InChIKey | CQKSKRWFRHZLTN-KSTNYAOJSA-N |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=C1SSC(=C2C(=O)N(c3ccccc3)N=C2C)S1 |
|
~%
(4Z)-5-methyl-4... CAS#:61656-33-5 |
| Literature: Takeshima,T. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1706 - 1708 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |