1-(2,4-dichloro-5-nitrophenyl)ethanone structure
|
Common Name | 1-(2,4-dichloro-5-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 61671-51-0 | Molecular Weight | 234.03600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,4-dichloro-5-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5Cl2NO3 |
|---|---|
| Molecular Weight | 234.03600 |
| Exact Mass | 232.96500 |
| PSA | 62.89000 |
| LogP | 3.62740 |
| InChIKey | OMEKMKKSSHGMLT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl |
|
~%
1-(2,4-dichloro... CAS#:61671-51-0 |
| Literature: Sacha; Patel Journal of the Indian Chemical Society, 1957 , vol. 34, p. 821,824 |
| 2',4'-dichloro-5'-nitro-acetophenone |