3,3,5-trimethylcyclohexa-1,5-diene-1-carboxylic acid structure
|
Common Name | 3,3,5-trimethylcyclohexa-1,5-diene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 61685-32-3 | Molecular Weight | 166.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,5-trimethylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14O2 |
|---|---|
| Molecular Weight | 166.21700 |
| Exact Mass | 166.09900 |
| PSA | 37.30000 |
| LogP | 2.37360 |
| InChIKey | NSKXYUHDFOQPNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(C(=O)O)=CC(C)(C)C1 |
|
~%
3,3,5-trimethyl... CAS#:61685-32-3 |
| Literature: Stemke,J.E. et al. Tetrahedron Letters, 1976 , p. 2947 - 2950 |
|
~%
3,3,5-trimethyl... CAS#:61685-32-3 |
| Literature: Braude; Evans Journal of the Chemical Society, 1954 , p. 607,613 |
| 3,3,5-trimethyl-cyclohexa-1,5-diene-1-carboxylic acid |
| 1,5-Cyclohexadiene-1-carboxylic acid,3,3,5-trimethyl |
| 3,3,5-trimethyl-1,5-cyclohexadiene-1-carboxylic acid |
| 3,3,5-Trimethyl-cyclohexa-1,5-diencarbonsaeure |