1-methyl-4-[3-[4-(trifluoromethyl)phenyl]prop-1-ynyl]benzene structure
|
Common Name | 1-methyl-4-[3-[4-(trifluoromethyl)phenyl]prop-1-ynyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 61692-93-1 | Molecular Weight | 274.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-[3-[4-(trifluoromethyl)phenyl]prop-1-ynyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13F3 |
|---|---|
| Molecular Weight | 274.28000 |
| Exact Mass | 274.09700 |
| LogP | 4.60800 |
| InChIKey | QYQXBKLXZQUPJW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C#CCc2ccc(C(F)(F)F)cc2)cc1 |
|
~%
1-methyl-4-[3-[... CAS#:61692-93-1 |
| Literature: van Rossum,A.J.G.; Nivard,R.J.F. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1322 - 1326 |
| 1-p-Trifluormethylphenyl-3-p-tolylpropin-3 |