1,3-dichloro-5-(3-phenylpropa-1,2-dienyl)benzene structure
|
Common Name | 1,3-dichloro-5-(3-phenylpropa-1,2-dienyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 61693-00-3 | Molecular Weight | 261.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dichloro-5-(3-phenylpropa-1,2-dienyl)benzene |
|---|
| Molecular Formula | C15H10Cl2 |
|---|---|
| Molecular Weight | 261.14600 |
| Exact Mass | 260.01600 |
| LogP | 5.31890 |
| InChIKey | YPYOFNGIDGFXAD-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(C=C=Cc2ccccc2)c1 |
|
~%
1,3-dichloro-5-... CAS#:61693-00-3 |
| Literature: van Rossum,A.J.G.; Nivard,R.J.F. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1322 - 1326 |
|
~%
1,3-dichloro-5-... CAS#:61693-00-3 |
| Literature: van Rossum,A.J.G.; Nivard,R.J.F. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1322 - 1326 |
|
~%
1,3-dichloro-5-... CAS#:61693-00-3 |
| Literature: van Rossum,A.J.G.; Nivard,R.J.F. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1322 - 1326 |