4,7,13,16-Tetraoxa-1,10,26-triazatricyclo[8.8.7.120,24]exacosa-20,22,24(26)-triene-19,25-dione structure
|
Common Name | 4,7,13,16-Tetraoxa-1,10,26-triazatricyclo[8.8.7.120,24]exacosa-20,22,24(26)-triene-19,25-dione | ||
|---|---|---|---|---|
| CAS Number | 61696-67-1 | Molecular Weight | 393.43400 | |
| Density | 1.28g/cm3 | Boiling Point | 658.3ºC at 760 mmHg | |
| Molecular Formula | C19H27N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.9ºC | |
| Name | Pyridinophane cryptand |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 658.3ºC at 760 mmHg |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.43400 |
| Flash Point | 351.9ºC |
| Exact Mass | 393.19000 |
| PSA | 90.43000 |
| Index of Refraction | 1.571 |
| InChIKey | MXPQFLYNVLNUDN-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc(n2)C(=O)N2CCOCCOCCN1CCOCCOCC2 |
|
~%
4,7,13,16-Tetra... CAS#:61696-67-1 |
| Literature: Tuemmler; Maass; Weber; Wehner; Voegtle Journal of the American Chemical Society, 1977 , vol. 99, # 14 p. 4683 - 4690 |
|
~%
4,7,13,16-Tetra... CAS#:61696-67-1 |
| Literature: Wehner,W.; Voegtle,F. Tetrahedron Letters, 1976 , p. 2603 - 2606 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |