2-(2-hydroxy-2-phenylethyl)-4-methylnaphthalene-1,3-diol structure
|
Common Name | 2-(2-hydroxy-2-phenylethyl)-4-methylnaphthalene-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 61705-33-7 | Molecular Weight | 294.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxy-2-phenylethyl)-4-methylnaphthalene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H18O3 |
|---|---|
| Molecular Weight | 294.34400 |
| Exact Mass | 294.12600 |
| PSA | 60.69000 |
| LogP | 3.83550 |
| InChIKey | YJYKQQDBCYYRJN-UHFFFAOYSA-N |
| SMILES | Cc1c(O)c(CC(O)c2ccccc2)c(O)c2ccccc12 |
|
~%
2-(2-hydroxy-2-... CAS#:61705-33-7 |
| Literature: Otsuki,T. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, # 9 p. 2596 - 2605 |
| 2-(2-Hydroxy-2-phenylaethyl)-4-methyl-naphthalindiol-(1,3) |
| 1,3-Naphthalenediol,2-(2-hydroxy-2-phenylethyl)-4-methyl |